C17H18ClNO4S — CID 8942013
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-(4-chlorophenyl)thiophene-2-carboxylate (PubChem CID 8942013) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-(4-chlorophenyl)thiophene-2-carboxylate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-(4-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8942013 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 5-(4-chlorophenyl)thiophene-2-carboxylate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)c1ccc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-11(16(20)19-9-10-22-2)23-17(21)15-8-7-14(24-15)12-3-5-13(18)6-4-12/h3-8,11H,9-10H2,1-2H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | NVLDGRMFINUGSW-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|