C17H15BrN2O3S — CID 112839566
3-[5-(4-bromophenyl)thiophen-2-yl]-2-cyano-N-(2-methoxyethyl)-3-oxopropanamide (PubChem CID 112839566) has the molecular formula C17H15BrN2O3S and a molecular weight of 407.29 g/mol. Its IUPAC name is 3-[5-(4-bromophenyl)thiophen-2-yl]-2-cyano-N-(2-methoxyethyl)-3-oxopropanamide.
| Compound Name | 3-[5-(4-bromophenyl)thiophen-2-yl]-2-cyano-N-(2-methoxyethyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 112839566 |
| Molecular Formula | C17H15BrN2O3S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 3-[5-(4-bromophenyl)thiophen-2-yl]-2-cyano-N-(2-methoxyethyl)-3-oxopropanamide |
| SMILES | COCCNC(=O)C(C#N)C(=O)c1ccc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C17H15BrN2O3S/c1-23-9-8-20-17(22)13(10-19)16(21)15-7-6-14(24-15)11-2-4-12(18)5-3-11/h2-7,13H,8-9H2,1H3,(H,20,22) |
| InChIKey | ZTPTYFMBTDPESP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|