C19H16BrNO3S — CID 38408482
5-(4-bromophenyl)-N-(2,4-dimethoxyphenyl)thiophene-2-carboxamide (PubChem CID 38408482) has the molecular formula C19H16BrNO3S and a molecular weight of 418.31 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(2,4-dimethoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-(2,4-dimethoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 38408482 |
| Molecular Formula | C19H16BrNO3S |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 5-(4-bromophenyl)-N-(2,4-dimethoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-c3ccc(Br)cc3)s2)c(OC)c1 |
| InChI | InChI=1S/C19H16BrNO3S/c1-23-14-7-8-15(16(11-14)24-2)21-19(22)18-10-9-17(25-18)12-3-5-13(20)6-4-12/h3-11H,1-2H3,(H,21,22) |
| InChIKey | PJIZFJWEHYEKDR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |