C12H11NO3S — CID 58657217
N-hydroxy-5-(4-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 58657217) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is N-hydroxy-5-(4-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | N-hydroxy-5-(4-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58657217 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | N-hydroxy-5-(4-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)NO)s2)cc1 |
| InChI | InChI=1S/C12H11NO3S/c1-16-9-4-2-8(3-5-9)10-6-7-11(17-10)12(14)13-15/h2-7,15H,1H3,(H,13,14) |
| InChIKey | PQTKEIBJOIDBMF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|