C15H12O5S — CID 68591897
(E)-2-hydroxy-4-[5-(4-methoxyphenyl)thiophen-2-yl]-4-oxobut-2-enoic acid (PubChem CID 68591897) has the molecular formula C15H12O5S and a molecular weight of 304.32 g/mol. Its IUPAC name is (E)-2-hydroxy-4-[5-(4-methoxyphenyl)thiophen-2-yl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-2-hydroxy-4-[5-(4-methoxyphenyl)thiophen-2-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 68591897 |
| Molecular Formula | C15H12O5S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (E)-2-hydroxy-4-[5-(4-methoxyphenyl)thiophen-2-yl]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)/C=C(/O)C(=O)O)s2)cc1 |
| InChI | InChI=1S/C15H12O5S/c1-20-10-4-2-9(3-5-10)13-6-7-14(21-13)11(16)8-12(17)15(18)19/h2-8,17H,1H3,(H,18,19)/b12-8+ |
| InChIKey | IIGLGZZQIMVUBL-XYOKQWHBSA-N |
| XLogP | 3.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|