C22H18O3S — CID 19596431
1-[5-(4-ethenylphenyl)thiophen-2-yl]-3-(4-methoxyphenyl)propane-1,3-dione (PubChem CID 19596431) has the molecular formula C22H18O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[5-(4-ethenylphenyl)thiophen-2-yl]-3-(4-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-[5-(4-ethenylphenyl)thiophen-2-yl]-3-(4-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 19596431 |
| Molecular Formula | C22H18O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[5-(4-ethenylphenyl)thiophen-2-yl]-3-(4-methoxyphenyl)propane-1,3-dione |
| SMILES | C=Cc1ccc(-c2ccc(C(=O)CC(=O)c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C22H18O3S/c1-3-15-4-6-17(7-5-15)21-12-13-22(26-21)20(24)14-19(23)16-8-10-18(25-2)11-9-16/h3-13H,1,14H2,2H3 |
| InChIKey | LKTMWTYHWDENSA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|