C18H14O3S — CID 56928772
(3-hydroxyphenyl)-[5-(4-methoxyphenyl)thiophen-2-yl]methanone (PubChem CID 56928772) has the molecular formula C18H14O3S and a molecular weight of 310.37 g/mol. Its IUPAC name is (3-hydroxyphenyl)-[5-(4-methoxyphenyl)thiophen-2-yl]methanone.
| Compound Name | (3-hydroxyphenyl)-[5-(4-methoxyphenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 56928772 |
| Molecular Formula | C18H14O3S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (3-hydroxyphenyl)-[5-(4-methoxyphenyl)thiophen-2-yl]methanone |
| SMILES | COc1ccc(-c2ccc(C(=O)c3cccc(O)c3)s2)cc1 |
| InChI | InChI=1S/C18H14O3S/c1-21-15-7-5-12(6-8-15)16-9-10-17(22-16)18(20)13-3-2-4-14(19)11-13/h2-11,19H,1H3 |
| InChIKey | HPUJXICXVBZDKT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |