C21H18N2OS — CID 130351409
2-[(2E,4E)-5-[5-(4-methoxyphenyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile (PubChem CID 130351409) has the molecular formula C21H18N2OS and a molecular weight of 346.46 g/mol. Its IUPAC name is 2-[(2E,4E)-5-[5-(4-methoxyphenyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile.
| Compound Name | 2-[(2E,4E)-5-[5-(4-methoxyphenyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile |
|---|---|
| PubChem CID | 130351409 |
| Molecular Formula | C21H18N2OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-[(2E,4E)-5-[5-(4-methoxyphenyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile |
| SMILES | COc1ccc(-c2ccc(/C(C)=C/C=C(\C)C=C(C#N)C#N)s2)cc1 |
| InChI | InChI=1S/C21H18N2OS/c1-15(12-17(13-22)14-23)4-5-16(2)20-10-11-21(25-20)18-6-8-19(24-3)9-7-18/h4-12H,1-3H3/b15-4+,16-5+ |
| InChIKey | VPGYDEOUMLEPET-PGCXOTJKSA-N |
| XLogP | 5.75 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|