C18H16O2S — CID 3552928
2,5-bis(4-methoxyphenyl)thiophene (PubChem CID 3552928) has the molecular formula C18H16O2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2,5-bis(4-methoxyphenyl)thiophene.
| Compound Name | 2,5-bis(4-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 3552928 |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2,5-bis(4-methoxyphenyl)thiophene |
| SMILES | COc1ccc(-c2ccc(-c3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C18H16O2S/c1-19-15-7-3-13(4-8-15)17-11-12-18(21-17)14-5-9-16(20-2)10-6-14/h3-12H,1-2H3 |
| InChIKey | SNVBIBDQUGLRIV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |