C19H24O6S — CID 56680495
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-methoxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol (PubChem CID 56680495) has the molecular formula C19H24O6S and a molecular weight of 380.46 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-methoxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-methoxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56680495 |
| Molecular Formula | C19H24O6S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-methoxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2C)cc1 |
| InChI | InChI=1S/C19H24O6S/c1-10-12(7-11-3-5-13(24-2)6-4-11)8-15(26-10)19-18(23)17(22)16(21)14(9-20)25-19/h3-6,8,14,16-23H,7,9H2,1-2H3/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | PORNCOGKKTUOIB-FTWQHDNSSA-N |
| XLogP | 1.17 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |