C22H24O6S — CID 10070513
(2S,3R,4R,5S,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10070513) has the molecular formula C22H24O6S and a molecular weight of 416.50 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10070513 |
| Molecular Formula | C22H24O6S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-(1-benzothiophen-2-ylmethyl)-4-methoxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1cc2ccccc2s1 |
| InChI | InChI=1S/C22H24O6S/c1-27-16-7-6-13(22-21(26)20(25)19(24)17(11-23)28-22)8-14(16)10-15-9-12-4-2-3-5-18(12)29-15/h2-9,17,19-26H,10-11H2,1H3/t17-,19-,20+,21-,22+/m1/s1 |
| InChIKey | IHLRUYNBFMWRGJ-VOFPXKNKSA-N |
| XLogP | 2.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |