C18H22O6S — CID 56677009
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-hydroxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol (PubChem CID 56677009) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-hydroxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-hydroxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56677009 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[(4-hydroxyphenyl)methyl]-5-methylthiophen-2-yl]oxane-3,4,5-triol |
| SMILES | Cc1sc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H22O6S/c1-9-11(6-10-2-4-12(20)5-3-10)7-14(25-9)18-17(23)16(22)15(21)13(8-19)24-18/h2-5,7,13,15-23H,6,8H2,1H3/t13-,15-,16+,17-,18+/m1/s1 |
| InChIKey | UPYQSAFSUDDQJN-LHKMKVQPSA-N |
| XLogP | 0.87 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |