C20H23ClO6S — CID 56663481
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56663481) has the molecular formula C20H23ClO6S and a molecular weight of 426.92 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56663481 |
| Molecular Formula | C20H23ClO6S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C20H23ClO6S/c1-2-7-26-13-5-3-11(4-6-13)8-12-9-15(28-20(12)21)19-18(25)17(24)16(23)14(10-22)27-19/h2-6,9,14,16-19,22-25H,1,7-8,10H2/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | DBHDSGVPTUJUNY-FTWQHDNSSA-N |
| XLogP | 2.07 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|