C18H21ClO5S — CID 56670267
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56670267) has the molecular formula C18H21ClO5S and a molecular weight of 384.88 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56670267 |
| Molecular Formula | C18H21ClO5S |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-methylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C18H21ClO5S/c1-9-2-4-10(5-3-9)6-11-7-13(25-18(11)19)17-16(23)15(22)14(21)12(8-20)24-17/h2-5,7,12,14-17,20-23H,6,8H2,1H3/t12-,14-,15+,16-,17+/m1/s1 |
| InChIKey | KIIARJOCZNLEIZ-CMZRPVNOSA-N |
| XLogP | 1.82 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |