C21H20ClFO5S2 — CID 56659942
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56659942) has the molecular formula C21H20ClFO5S2 and a molecular weight of 470.97 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56659942 |
| Molecular Formula | C21H20ClFO5S2 |
| Molecular Weight | 470.97 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(-c4ccc(F)cc4)s3)c(Cl)s2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H20ClFO5S2/c22-21-11(7-13-5-6-15(29-13)10-1-3-12(23)4-2-10)8-16(30-21)20-19(27)18(26)17(25)14(9-24)28-20/h1-6,8,14,17-20,24-27H,7,9H2/t14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | FLNJXWJFZOTRDA-QSWMPLQWSA-N |
| XLogP | 3.37 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.97 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |