C20H25ClO5S — CID 56659941
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56659941) has the molecular formula C20H25ClO5S and a molecular weight of 412.94 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56659941 |
| Molecular Formula | C20H25ClO5S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propylphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C20H25ClO5S/c1-2-3-11-4-6-12(7-5-11)8-13-9-15(27-20(13)21)19-18(25)17(24)16(23)14(10-22)26-19/h4-7,9,14,16-19,22-25H,2-3,8,10H2,1H3/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | LGCMWVFFANEOOU-FTWQHDNSSA-N |
| XLogP | 2.46 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |