C18H21ClO6S — CID 149372509
(2R,3R,4S,5S)-2-[5-chloro-4-[(4-methoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 149372509) has the molecular formula C18H21ClO6S and a molecular weight of 400.88 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[5-chloro-4-[(4-methoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[5-chloro-4-[(4-methoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 149372509 |
| Molecular Formula | C18H21ClO6S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (2R,3R,4S,5S)-2-[5-chloro-4-[(4-methoxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cc([C@@H]3OC(CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C18H21ClO6S/c1-24-11-4-2-9(3-5-11)6-10-7-13(26-18(10)19)17-16(23)15(22)14(21)12(8-20)25-17/h2-5,7,12,14-17,20-23H,6,8H2,1H3/t12?,14-,15+,16-,17+/m1/s1 |
| InChIKey | YKBUVGDLUNQZHJ-DAQHESOFSA-N |
| XLogP | 1.52 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |