C18H22ClNO5S — CID 46927885
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46927885) has the molecular formula C18H22ClNO5S and a molecular weight of 399.90 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46927885 |
| Molecular Formula | C18H22ClNO5S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-ethylphenyl)methyl]-1,3-thiazol-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2nc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO5S/c1-2-9-3-5-10(6-4-9)7-11-17(19)26-18(20-11)16-15(24)14(23)13(22)12(8-21)25-16/h3-6,12-16,21-24H,2,7-8H2,1H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | YILSSRKNDFXMKP-IBEHDNSVSA-N |
| XLogP | 1.46 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |