C19H21ClO8 — CID 155680759
(2S,3R,4R,5S,6R)-2-[3-[(4-chlorophenyl)methyl]-2,4,6-trihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 155680759) has the molecular formula C19H21ClO8 and a molecular weight of 412.82 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[(4-chlorophenyl)methyl]-2,4,6-trihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[(4-chlorophenyl)methyl]-2,4,6-trihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155680759 |
| Molecular Formula | C19H21ClO8 |
| Molecular Weight | 412.82 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[(4-chlorophenyl)methyl]-2,4,6-trihydroxyphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2c(O)cc(O)c(Cc3ccc(Cl)cc3)c2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H21ClO8/c20-9-3-1-8(2-4-9)5-10-11(22)6-12(23)14(15(10)24)19-18(27)17(26)16(25)13(7-21)28-19/h1-4,6,13,16-19,21-27H,5,7H2/t13-,16-,17+,18-,19+/m1/s1 |
| InChIKey | QZGDFARNEUDJMI-SFKBXODTSA-N |
| XLogP | 0.56 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.82 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |