C22H23FO5S2 — CID 56673698
(2R,3R,4S,5S,6R)-2-[4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-5-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56673698) has the molecular formula C22H23FO5S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-5-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-5-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56673698 |
| Molecular Formula | C22H23FO5S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-5-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1sc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H23FO5S2/c1-11-13(8-15-6-7-17(30-15)12-2-4-14(23)5-3-12)9-18(29-11)22-21(27)20(26)19(25)16(10-24)28-22/h2-7,9,16,19-22,24-27H,8,10H2,1H3/t16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | OYQCMVGIBJEEOT-OSKXVONFSA-N |
| XLogP | 3.03 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |