C21H25ClO7S — CID 56663408
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[[4-(oxolan-3-yloxy)phenyl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56663408) has the molecular formula C21H25ClO7S and a molecular weight of 456.94 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[[4-(oxolan-3-yloxy)phenyl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[[4-(oxolan-3-yloxy)phenyl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56663408 |
| Molecular Formula | C21H25ClO7S |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[[4-(oxolan-3-yloxy)phenyl]methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(OC4CCOC4)cc3)c(Cl)s2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H25ClO7S/c22-21-12(7-11-1-3-13(4-2-11)28-14-5-6-27-10-14)8-16(30-21)20-19(26)18(25)17(24)15(9-23)29-20/h1-4,8,14-15,17-20,23-26H,5-7,9-10H2/t14?,15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | SEHAOHGADQPFJS-TVXCUULYSA-N |
| XLogP | 1.67 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |