C21H23ClO6S — CID 56666838
(2R,3R,4S,5S,6R)-2-[4-[(4-but-2-ynoxyphenyl)methyl]-5-chlorothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56666838) has the molecular formula C21H23ClO6S and a molecular weight of 438.93 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-[(4-but-2-ynoxyphenyl)methyl]-5-chlorothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-[(4-but-2-ynoxyphenyl)methyl]-5-chlorothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56666838 |
| Molecular Formula | C21H23ClO6S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-[(4-but-2-ynoxyphenyl)methyl]-5-chlorothiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC#CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClO6S/c1-2-3-8-27-14-6-4-12(5-7-14)9-13-10-16(29-21(13)22)20-19(26)18(25)17(24)15(11-23)28-20/h4-7,10,15,17-20,23-26H,8-9,11H2,1H3/t15-,17-,18+,19-,20+/m1/s1 |
| InChIKey | GXEJJEOWHGWRBW-PKOFMYQESA-N |
| XLogP | 1.91 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|