C20H25ClO6S — CID 56666839
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propan-2-yloxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56666839) has the molecular formula C20H25ClO6S and a molecular weight of 428.93 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propan-2-yloxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propan-2-yloxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56666839 |
| Molecular Formula | C20H25ClO6S |
| Molecular Weight | 428.93 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-propan-2-yloxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)Oc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2Cl)cc1 |
| InChI | InChI=1S/C20H25ClO6S/c1-10(2)26-13-5-3-11(4-6-13)7-12-8-15(28-20(12)21)19-18(25)17(24)16(23)14(9-22)27-19/h3-6,8,10,14,16-19,22-25H,7,9H2,1-2H3/t14-,16-,17+,18-,19+/m1/s1 |
| InChIKey | FJRMNCPUJYIBGD-FTWQHDNSSA-N |
| XLogP | 2.29 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.93 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |