C20H25BrO5S — CID 54597682
(2R,3R,4S,5S,6R)-2-[3-bromo-5-[(4-ethylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 54597682) has the molecular formula C20H25BrO5S and a molecular weight of 457.39 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-bromo-5-[(4-ethylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-bromo-5-[(4-ethylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54597682 |
| Molecular Formula | C20H25BrO5S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-bromo-5-[(4-ethylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2sc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(Br)c2C)cc1 |
| InChI | InChI=1S/C20H25BrO5S/c1-3-11-4-6-12(7-5-11)8-14-10(2)15(21)20(27-14)19-18(25)17(24)16(23)13(9-22)26-19/h4-7,13,16-19,22-25H,3,8-9H2,1-2H3/t13-,16-,17+,18-,19-/m1/s1 |
| InChIKey | YFVFERGZEHBXRN-LQDZTQBFSA-N |
| XLogP | 2.49 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |