C20H26O6S — CID 56673699
(2R,3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56673699) has the molecular formula C20H26O6S and a molecular weight of 394.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56673699 |
| Molecular Formula | C20H26O6S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2sc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2C)cc1 |
| InChI | InChI=1S/C20H26O6S/c1-3-25-13-6-4-12(5-7-13)9-15-11(2)8-16(27-15)20-19(24)18(23)17(22)14(10-21)26-20/h4-8,14,17-24H,3,9-10H2,1-2H3/t14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | MBTYCWPMPCMIAK-QSWMPLQWSA-N |
| XLogP | 1.56 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |