C21H26O6S — CID 56683663
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[5-methyl-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol (PubChem CID 56683663) has the molecular formula C21H26O6S and a molecular weight of 406.50 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[5-methyl-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[5-methyl-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56683663 |
| Molecular Formula | C21H26O6S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[5-methyl-4-[(4-prop-2-enoxyphenyl)methyl]thiophen-2-yl]oxane-3,4,5-triol |
| SMILES | C=CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)sc2C)cc1 |
| InChI | InChI=1S/C21H26O6S/c1-3-8-26-15-6-4-13(5-7-15)9-14-10-17(28-12(14)2)21-20(25)19(24)18(23)16(11-22)27-21/h3-7,10,16,18-25H,1,8-9,11H2,2H3/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | VEWXOYYSRUHCPZ-RQXATKFSSA-N |
| XLogP | 1.73 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|