C16H12BrNO2S — CID 38404678
5-(4-bromophenyl)-N-(furan-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 38404678) has the molecular formula C16H12BrNO2S and a molecular weight of 362.25 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(furan-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 38404678 |
| Molecular Formula | C16H12BrNO2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 5-(4-bromophenyl)-N-(furan-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc(-c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C16H12BrNO2S/c17-12-5-3-11(4-6-12)14-7-8-15(21-14)16(19)18-10-13-2-1-9-20-13/h1-9H,10H2,(H,18,19) |
| InChIKey | XRUCCUMTYVXGCB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |