C17H13BrN2OS — CID 11610434
N-[(3-bromophenyl)methyl]-5-pyridin-4-ylthiophene-2-carboxamide (PubChem CID 11610434) has the molecular formula C17H13BrN2OS and a molecular weight of 373.28 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-5-pyridin-4-ylthiophene-2-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-5-pyridin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 11610434 |
| Molecular Formula | C17H13BrN2OS |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-5-pyridin-4-ylthiophene-2-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1ccc(-c2ccncc2)s1 |
| InChI | InChI=1S/C17H13BrN2OS/c18-14-3-1-2-12(10-14)11-20-17(21)16-5-4-15(22-16)13-6-8-19-9-7-13/h1-10H,11H2,(H,20,21) |
| InChIKey | VWRQAMQOGFMLDS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |