C17H14FNO2S — CID 18109835
5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-methylthiophene-2-carboxamide (PubChem CID 18109835) has the molecular formula C17H14FNO2S and a molecular weight of 315.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-methylthiophene-2-carboxamide.
| Compound Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18109835 |
| Molecular Formula | C17H14FNO2S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N-methylthiophene-2-carboxamide |
| SMILES | CN(Cc1ccco1)C(=O)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H14FNO2S/c1-19(11-14-3-2-10-21-14)17(20)16-9-8-15(22-16)12-4-6-13(18)7-5-12/h2-10H,11H2,1H3 |
| InChIKey | MZAVIYUDQPJPFL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |