C19H22FNOS — CID 56517770
N-cyclopentyl-5-(4-fluorophenyl)-N-propan-2-ylthiophene-2-carboxamide (PubChem CID 56517770) has the molecular formula C19H22FNOS and a molecular weight of 331.46 g/mol. Its IUPAC name is N-cyclopentyl-5-(4-fluorophenyl)-N-propan-2-ylthiophene-2-carboxamide.
| Compound Name | N-cyclopentyl-5-(4-fluorophenyl)-N-propan-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 56517770 |
| Molecular Formula | C19H22FNOS |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-cyclopentyl-5-(4-fluorophenyl)-N-propan-2-ylthiophene-2-carboxamide |
| SMILES | CC(C)N(C(=O)c1ccc(-c2ccc(F)cc2)s1)C1CCCC1 |
| InChI | InChI=1S/C19H22FNOS/c1-13(2)21(16-5-3-4-6-16)19(22)18-12-11-17(23-18)14-7-9-15(20)10-8-14/h7-13,16H,3-6H2,1-2H3 |
| InChIKey | LXJACZBVHBXEDZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |