C18H17NO6S — CID 8821537
2-(4-sulfamoylphenoxy)ethyl 2H-chromene-3-carboxylate (PubChem CID 8821537) has the molecular formula C18H17NO6S and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 2H-chromene-3-carboxylate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 8821537 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 2H-chromene-3-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)C2=Cc3ccccc3OC2)cc1 |
| InChI | InChI=1S/C18H17NO6S/c19-26(21,22)16-7-5-15(6-8-16)23-9-10-24-18(20)14-11-13-3-1-2-4-17(13)25-12-14/h1-8,11H,9-10,12H2,(H2,19,21,22) |
| InChIKey | AOLSYIIWXHHMFY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|