C13H13ClF2O3S — CID 114189808
4-(4,4-dimethylpent-2-ynoxy)-2,3-difluorobenzenesulfonyl chloride (PubChem CID 114189808) has the molecular formula C13H13ClF2O3S and a molecular weight of 322.76 g/mol. Its IUPAC name is 4-(4,4-dimethylpent-2-ynoxy)-2,3-difluorobenzenesulfonyl chloride.
| Compound Name | 4-(4,4-dimethylpent-2-ynoxy)-2,3-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 114189808 |
| Molecular Formula | C13H13ClF2O3S |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-(4,4-dimethylpent-2-ynoxy)-2,3-difluorobenzenesulfonyl chloride |
| SMILES | CC(C)(C)C#CCOc1ccc(S(=O)(=O)Cl)c(F)c1F |
| InChI | InChI=1S/C13H13ClF2O3S/c1-13(2,3)7-4-8-19-9-5-6-10(20(14,17)18)12(16)11(9)15/h5-6H,8H2,1-3H3 |
| InChIKey | FMDYIAFUDNONKN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|