C10H12Cl2N2O3S — CID 65375550
3,4-dichloro-N-propan-2-yl-5-sulfamoylbenzamide (PubChem CID 65375550) has the molecular formula C10H12Cl2N2O3S and a molecular weight of 311.19 g/mol. Its IUPAC name is 3,4-dichloro-N-propan-2-yl-5-sulfamoylbenzamide.
| Compound Name | 3,4-dichloro-N-propan-2-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375550 |
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 3,4-dichloro-N-propan-2-yl-5-sulfamoylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H12Cl2N2O3S/c1-5(2)14-10(15)6-3-7(11)9(12)8(4-6)18(13,16)17/h3-5H,1-2H3,(H,14,15)(H2,13,16,17) |
| InChIKey | XEUKAVZKTVFHDK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |