C13H18Cl2N2O3S — CID 103465720
3,4-dichloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide (PubChem CID 103465720) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 3,4-dichloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide.
| Compound Name | 3,4-dichloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 103465720 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3,4-dichloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide |
| SMILES | CCC(C)(C)CNC(=O)c1cc(Cl)c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-4-13(2,3)7-17-12(18)8-5-9(14)11(15)10(6-8)21(16,19)20/h5-6H,4,7H2,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | GSZDFZSCQUCPEL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |