C11H12Cl2N2O3S — CID 113486130
3,4-dichloro-N-(1-methylcyclopropyl)-5-sulfamoylbenzamide (PubChem CID 113486130) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-methylcyclopropyl)-5-sulfamoylbenzamide.
| Compound Name | 3,4-dichloro-N-(1-methylcyclopropyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 113486130 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 3,4-dichloro-N-(1-methylcyclopropyl)-5-sulfamoylbenzamide |
| SMILES | CC1(NC(=O)c2cc(Cl)c(Cl)c(S(N)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C11H12Cl2N2O3S/c1-11(2-3-11)15-10(16)6-4-7(12)9(13)8(5-6)19(14,17)18/h4-5H,2-3H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | BVBXFKLWUYFUTN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |