C13H17ClN2O3S — CID 65379790
3-chloro-N-(1-methylcyclopentyl)-5-sulfamoylbenzamide (PubChem CID 65379790) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 3-chloro-N-(1-methylcyclopentyl)-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-(1-methylcyclopentyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65379790 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-chloro-N-(1-methylcyclopentyl)-5-sulfamoylbenzamide |
| SMILES | CC1(NC(=O)c2cc(Cl)cc(S(N)(=O)=O)c2)CCCC1 |
| InChI | InChI=1S/C13H17ClN2O3S/c1-13(4-2-3-5-13)16-12(17)9-6-10(14)8-11(7-9)20(15,18)19/h6-8H,2-5H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | WNHNNUZZDKUIGS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |