C13H19ClN2O3S — CID 65386747
3-chloro-N-(4-methylpentyl)-5-sulfamoylbenzamide (PubChem CID 65386747) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-chloro-N-(4-methylpentyl)-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-(4-methylpentyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65386747 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-chloro-N-(4-methylpentyl)-5-sulfamoylbenzamide |
| SMILES | CC(C)CCCNC(=O)c1cc(Cl)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-9(2)4-3-5-16-13(17)10-6-11(14)8-12(7-10)20(15,18)19/h6-9H,3-5H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | XAKCKMSGCBLWFG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|