C14H17BrClNO — CID 107999496
3-bromo-4-chloro-N-(1-methylcyclohexyl)benzamide (PubChem CID 107999496) has the molecular formula C14H17BrClNO and a molecular weight of 330.65 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(1-methylcyclohexyl)benzamide.
| Compound Name | 3-bromo-4-chloro-N-(1-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 107999496 |
| Molecular Formula | C14H17BrClNO |
| Molecular Weight | 330.65 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-bromo-4-chloro-N-(1-methylcyclohexyl)benzamide |
| SMILES | CC1(NC(=O)c2ccc(Cl)c(Br)c2)CCCCC1 |
| InChI | InChI=1S/C14H17BrClNO/c1-14(7-3-2-4-8-14)17-13(18)10-5-6-12(16)11(15)9-10/h5-6,9H,2-4,7-8H2,1H3,(H,17,18) |
| InChIKey | RPYSNMGYBGIPQA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |