C14H17BrClNO3 — CID 110631720
3-bromo-4-chloro-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide (PubChem CID 110631720) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide.
| Compound Name | 3-bromo-4-chloro-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 110631720 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 3-bromo-4-chloro-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]benzamide |
| SMILES | O=C(NCC1(CO)CCOCC1)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H17BrClNO3/c15-11-7-10(1-2-12(11)16)13(19)17-8-14(9-18)3-5-20-6-4-14/h1-2,7,18H,3-6,8-9H2,(H,17,19) |
| InChIKey | HHXBOSKGCLMVHU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |