C12H14Cl2N2O3S — CID 65375967
3,4-dichloro-N-cyclopentyl-5-sulfamoylbenzamide (PubChem CID 65375967) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 3,4-dichloro-N-cyclopentyl-5-sulfamoylbenzamide.
| Compound Name | 3,4-dichloro-N-cyclopentyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375967 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3,4-dichloro-N-cyclopentyl-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NC2CCCC2)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N2O3S/c13-9-5-7(6-10(11(9)14)20(15,18)19)12(17)16-8-3-1-2-4-8/h5-6,8H,1-4H2,(H,16,17)(H2,15,18,19) |
| InChIKey | UWWKMTUERJYADL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |