C10H9Cl3N2O3S — CID 65375569
2,3,6-trichloro-N-cyclopropyl-5-sulfamoylbenzamide (PubChem CID 65375569) has the molecular formula C10H9Cl3N2O3S and a molecular weight of 343.62 g/mol. Its IUPAC name is 2,3,6-trichloro-N-cyclopropyl-5-sulfamoylbenzamide.
| Compound Name | 2,3,6-trichloro-N-cyclopropyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375569 |
| Molecular Formula | C10H9Cl3N2O3S |
| Molecular Weight | 343.62 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 2,3,6-trichloro-N-cyclopropyl-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(Cl)c(Cl)c(C(=O)NC2CC2)c1Cl |
| InChI | InChI=1S/C10H9Cl3N2O3S/c11-5-3-6(19(14,17)18)9(13)7(8(5)12)10(16)15-4-1-2-4/h3-4H,1-2H2,(H,15,16)(H2,14,17,18) |
| InChIKey | UDIVUINLKCTSDT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|