C19H27ClN2O5S2 — CID 126508892
4-chloro-N-cyclohexyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide (PubChem CID 126508892) has the molecular formula C19H27ClN2O5S2 and a molecular weight of 463.02 g/mol. Its IUPAC name is 4-chloro-N-cyclohexyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide.
| Compound Name | 4-chloro-N-cyclohexyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 126508892 |
| Molecular Formula | C19H27ClN2O5S2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-chloro-N-cyclohexyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cc(C(=O)NC2CCCCC2)c(S(=O)(=O)C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C19H27ClN2O5S2/c20-16-12-17(28(24,25)14-9-5-2-6-10-14)15(11-18(16)29(21,26)27)19(23)22-13-7-3-1-4-8-13/h11-14H,1-10H2,(H,22,23)(H2,21,26,27) |
| InChIKey | DBESSYOOZDFQBR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |