C17H25BrN2O5S2 — CID 126508968
4-bromo-N-butyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide (PubChem CID 126508968) has the molecular formula C17H25BrN2O5S2 and a molecular weight of 481.43 g/mol. Its IUPAC name is 4-bromo-N-butyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide.
| Compound Name | 4-bromo-N-butyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 126508968 |
| Molecular Formula | C17H25BrN2O5S2 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 4-bromo-N-butyl-2-cyclohexylsulfonyl-5-sulfamoylbenzamide |
| SMILES | CCCCNC(=O)c1cc(S(N)(=O)=O)c(Br)cc1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H25BrN2O5S2/c1-2-3-9-20-17(21)13-10-16(27(19,24)25)14(18)11-15(13)26(22,23)12-7-5-4-6-8-12/h10-12H,2-9H2,1H3,(H,20,21)(H2,19,24,25) |
| InChIKey | ADZJIEUIYRWVJN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|