C12H15Cl3N2O3S — CID 65374079
2,3,6-trichloro-N-pentan-3-yl-5-sulfamoylbenzamide (PubChem CID 65374079) has the molecular formula C12H15Cl3N2O3S and a molecular weight of 373.69 g/mol. Its IUPAC name is 2,3,6-trichloro-N-pentan-3-yl-5-sulfamoylbenzamide.
| Compound Name | 2,3,6-trichloro-N-pentan-3-yl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65374079 |
| Molecular Formula | C12H15Cl3N2O3S |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 2,3,6-trichloro-N-pentan-3-yl-5-sulfamoylbenzamide |
| SMILES | CCC(CC)NC(=O)c1c(Cl)c(Cl)cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C12H15Cl3N2O3S/c1-3-6(4-2)17-12(18)9-10(14)7(13)5-8(11(9)15)21(16,19)20/h5-6H,3-4H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | RXOAEYPEZCKYIK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|