C11H14BrClN2O3S — CID 65373817
5-bromo-N-butan-2-yl-2-chloro-3-sulfamoylbenzamide (PubChem CID 65373817) has the molecular formula C11H14BrClN2O3S and a molecular weight of 369.67 g/mol. Its IUPAC name is 5-bromo-N-butan-2-yl-2-chloro-3-sulfamoylbenzamide.
| Compound Name | 5-bromo-N-butan-2-yl-2-chloro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65373817 |
| Molecular Formula | C11H14BrClN2O3S |
| Molecular Weight | 369.67 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 5-bromo-N-butan-2-yl-2-chloro-3-sulfamoylbenzamide |
| SMILES | CCC(C)NC(=O)c1cc(Br)cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C11H14BrClN2O3S/c1-3-6(2)15-11(16)8-4-7(12)5-9(10(8)13)19(14,17)18/h4-6H,3H2,1-2H3,(H,15,16)(H2,14,17,18) |
| InChIKey | JAXPZHKITUYOMM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.67 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |