C13H18BrClN2O3S — CID 65386809
5-bromo-N-butan-2-yl-2-chloro-N-ethyl-3-sulfamoylbenzamide (PubChem CID 65386809) has the molecular formula C13H18BrClN2O3S and a molecular weight of 397.72 g/mol. Its IUPAC name is 5-bromo-N-butan-2-yl-2-chloro-N-ethyl-3-sulfamoylbenzamide.
| Compound Name | 5-bromo-N-butan-2-yl-2-chloro-N-ethyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65386809 |
| Molecular Formula | C13H18BrClN2O3S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 5-bromo-N-butan-2-yl-2-chloro-N-ethyl-3-sulfamoylbenzamide |
| SMILES | CCC(C)N(CC)C(=O)c1cc(Br)cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C13H18BrClN2O3S/c1-4-8(3)17(5-2)13(18)10-6-9(14)7-11(12(10)15)21(16,19)20/h6-8H,4-5H2,1-3H3,(H2,16,19,20) |
| InChIKey | FDFXRZRTMGNVLZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |