C13H17Br2NO — CID 107980072
3,5-dibromo-N-butan-2-yl-N-ethylbenzamide (PubChem CID 107980072) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 3,5-dibromo-N-butan-2-yl-N-ethylbenzamide.
| Compound Name | 3,5-dibromo-N-butan-2-yl-N-ethylbenzamide |
|---|---|
| PubChem CID | 107980072 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 3,5-dibromo-N-butan-2-yl-N-ethylbenzamide |
| SMILES | CCC(C)N(CC)C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H17Br2NO/c1-4-9(3)16(5-2)13(17)10-6-11(14)8-12(15)7-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | SQZMZPYXVBCNNI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |