C12H16BrClN2O4S — CID 104766693
5-bromo-2-chloro-N-(2-propan-2-yloxyethyl)-3-sulfamoylbenzamide (PubChem CID 104766693) has the molecular formula C12H16BrClN2O4S and a molecular weight of 399.69 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-propan-2-yloxyethyl)-3-sulfamoylbenzamide.
| Compound Name | 5-bromo-2-chloro-N-(2-propan-2-yloxyethyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 104766693 |
| Molecular Formula | C12H16BrClN2O4S |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-propan-2-yloxyethyl)-3-sulfamoylbenzamide |
| SMILES | CC(C)OCCNC(=O)c1cc(Br)cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C12H16BrClN2O4S/c1-7(2)20-4-3-16-12(17)9-5-8(13)6-10(11(9)14)21(15,18)19/h5-7H,3-4H2,1-2H3,(H,16,17)(H2,15,18,19) |
| InChIKey | MJBDXYYZHQFEGG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|