C13H18BrClN2O3S — CID 103465788
3-bromo-2-chloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide (PubChem CID 103465788) has the molecular formula C13H18BrClN2O3S and a molecular weight of 397.72 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide.
| Compound Name | 3-bromo-2-chloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 103465788 |
| Molecular Formula | C13H18BrClN2O3S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 3-bromo-2-chloro-N-(2,2-dimethylbutyl)-5-sulfamoylbenzamide |
| SMILES | CCC(C)(C)CNC(=O)c1cc(S(N)(=O)=O)cc(Br)c1Cl |
| InChI | InChI=1S/C13H18BrClN2O3S/c1-4-13(2,3)7-17-12(18)9-5-8(21(16,19)20)6-10(14)11(9)15/h5-6H,4,7H2,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | TUVKJICCLYFAKZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |