C10H10BrClF2N2O3S — CID 99719134
3-bromo-2-chloro-N-(2,2-difluoroethyl)-N-methyl-5-sulfamoylbenzamide (PubChem CID 99719134) has the molecular formula C10H10BrClF2N2O3S and a molecular weight of 391.62 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(2,2-difluoroethyl)-N-methyl-5-sulfamoylbenzamide.
| Compound Name | 3-bromo-2-chloro-N-(2,2-difluoroethyl)-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 99719134 |
| Molecular Formula | C10H10BrClF2N2O3S |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 3-bromo-2-chloro-N-(2,2-difluoroethyl)-N-methyl-5-sulfamoylbenzamide |
| SMILES | CN(CC(F)F)C(=O)c1cc(S(N)(=O)=O)cc(Br)c1Cl |
| InChI | InChI=1S/C10H10BrClF2N2O3S/c1-16(4-8(13)14)10(17)6-2-5(20(15,18)19)3-7(11)9(6)12/h2-3,8H,4H2,1H3,(H2,15,18,19) |
| InChIKey | ORMMXTQAIQNVIA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |